C31H42O6 — CID 101241449
ethyl (E)-3-[(4R,5R,10S)-1-oxo-5,10-bis(phenylmethoxy)dodecan-4-yl]oxyprop-2-enoate (PubChem CID 101241449) has the molecular formula C31H42O6 and a molecular weight of 510.67 g/mol. Its IUPAC name is ethyl (E)-3-[(4R,5R,10S)-1-oxo-5,10-bis(phenylmethoxy)dodecan-4-yl]oxyprop-2-enoate.
| Compound Name | ethyl (E)-3-[(4R,5R,10S)-1-oxo-5,10-bis(phenylmethoxy)dodecan-4-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 101241449 |
| Molecular Formula | C31H42O6 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | ethyl (E)-3-[(4R,5R,10S)-1-oxo-5,10-bis(phenylmethoxy)dodecan-4-yl]oxyprop-2-enoate |
| SMILES | CCOC(=O)/C=C/O[C@H](CCC=O)[C@@H](CCCC[C@H](CC)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H42O6/c1-3-28(36-24-26-14-7-5-8-15-26)18-11-12-19-30(37-25-27-16-9-6-10-17-27)29(20-13-22-32)35-23-21-31(33)34-4-2/h5-10,14-17,21-23,28-30H,3-4,11-13,18-20,24-25H2,1-2H3/b23-21+/t28-,29+,30+/m0/s1 |
| InChIKey | WFIDHZRWJHHAKX-GFPODBNZSA-N |
| XLogP | 6.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|