C34H58O10 — CID 11802084
ethyl (E,4R,5S,6S,9R,10S,11R,12R)-5,9,11-tris(methoxymethoxy)-14-[(4-methoxyphenyl)methoxy]-4,6,10,12-tetramethyltetradec-2-enoate (PubChem CID 11802084) has the molecular formula C34H58O10 and a molecular weight of 626.83 g/mol. Its IUPAC name is ethyl (E,4R,5S,6S,9R,10S,11R,12R)-5,9,11-tris(methoxymethoxy)-14-[(4-methoxyphenyl)methoxy]-4,6,10,12-tetramethyltetradec-2-enoate.
| Compound Name | ethyl (E,4R,5S,6S,9R,10S,11R,12R)-5,9,11-tris(methoxymethoxy)-14-[(4-methoxyphenyl)methoxy]-4,6,10,12-tetramethyltetradec-2-enoate |
|---|---|
| PubChem CID | 11802084 |
| Molecular Formula | C34H58O10 |
| Molecular Weight | 626.83 g/mol |
| Exact Mass | 626.40 |
| IUPAC Name | ethyl (E,4R,5S,6S,9R,10S,11R,12R)-5,9,11-tris(methoxymethoxy)-14-[(4-methoxyphenyl)methoxy]-4,6,10,12-tetramethyltetradec-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](C)[C@@H](OCOC)[C@@H](C)CC[C@@H](OCOC)[C@H](C)[C@H](OCOC)[C@H](C)CCOCc1ccc(OC)cc1 |
| InChI | InChI=1S/C34H58O10/c1-10-41-32(35)18-12-26(3)33(43-23-37-7)25(2)11-17-31(42-22-36-6)28(5)34(44-24-38-8)27(4)19-20-40-21-29-13-15-30(39-9)16-14-29/h12-16,18,25-28,31,33-34H,10-11,17,19-24H2,1-9H3/b18-12+/t25-,26+,27+,28-,31+,33-,34+/m0/s1 |
| InChIKey | ZJGRVBFXXUYJQE-NPDFEUOJSA-N |
| XLogP | 6.01 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|