C23H33NO7 — CID 50900626
methyl (2R,3S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxypent-4-enoate (PubChem CID 50900626) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is methyl (2R,3S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxypent-4-enoate.
| Compound Name | methyl (2R,3S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxypent-4-enoate |
|---|---|
| PubChem CID | 50900626 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | methyl (2R,3S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylmethoxypent-4-enoate |
| SMILES | C=C[C@H](OCc1ccccc1)[C@H](C(=O)OC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33NO7/c1-9-17(29-15-16-13-11-10-12-14-16)18(19(25)28-8)24(20(26)30-22(2,3)4)21(27)31-23(5,6)7/h9-14,17-18H,1,15H2,2-8H3/t17-,18+/m0/s1 |
| InChIKey | YYLQPHGPLSLIHZ-ZWKOTPCHSA-N |
| XLogP | 4.47 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|