C18H26F3NO4Si — CID 68945008
(2R,3R)-3-benzamido-4,4,4-trifluoro-2-methyl-2-triethylsilyloxybutanoic acid (PubChem CID 68945008) has the molecular formula C18H26F3NO4Si and a molecular weight of 405.49 g/mol. Its IUPAC name is (2R,3R)-3-benzamido-4,4,4-trifluoro-2-methyl-2-triethylsilyloxybutanoic acid.
| Compound Name | (2R,3R)-3-benzamido-4,4,4-trifluoro-2-methyl-2-triethylsilyloxybutanoic acid |
|---|---|
| PubChem CID | 68945008 |
| Molecular Formula | C18H26F3NO4Si |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (2R,3R)-3-benzamido-4,4,4-trifluoro-2-methyl-2-triethylsilyloxybutanoic acid |
| SMILES | CC[Si](CC)(CC)O[C@@](C)(C(=O)O)[C@@H](NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H26F3NO4Si/c1-5-27(6-2,7-3)26-17(4,16(24)25)15(18(19,20)21)22-14(23)13-11-9-8-10-12-13/h8-12,15H,5-7H2,1-4H3,(H,22,23)(H,24,25)/t15-,17-/m1/s1 |
| InChIKey | UBPZMAJXBDOTMC-NVXWUHKLSA-N |
| XLogP | 4.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|