C15H20F3NO3 — CID 157327798
(4-benzamido-5,5,5-trifluoropentyl) acetate;methane (PubChem CID 157327798) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is (4-benzamido-5,5,5-trifluoropentyl) acetate;methane.
| Compound Name | (4-benzamido-5,5,5-trifluoropentyl) acetate;methane |
|---|---|
| PubChem CID | 157327798 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (4-benzamido-5,5,5-trifluoropentyl) acetate;methane |
| SMILES | C.CC(=O)OCCCC(NC(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO3.CH4/c1-10(19)21-9-5-8-12(14(15,16)17)18-13(20)11-6-3-2-4-7-11;/h2-4,6-7,12H,5,8-9H2,1H3,(H,18,20);1H4 |
| InChIKey | BEXYHFUUEZXMJS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|