C20H20Cl2N4O3S2 — CID 102311045
O-ethyl [1-[(2,6-dichloropyrimidin-4-yl)amino]-5-(1,3-dioxoisoindol-2-yl)pentan-3-yl]sulfanylmethanethioate (PubChem CID 102311045) has the molecular formula C20H20Cl2N4O3S2 and a molecular weight of 499.45 g/mol. Its IUPAC name is O-ethyl [1-[(2,6-dichloropyrimidin-4-yl)amino]-5-(1,3-dioxoisoindol-2-yl)pentan-3-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [1-[(2,6-dichloropyrimidin-4-yl)amino]-5-(1,3-dioxoisoindol-2-yl)pentan-3-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 102311045 |
| Molecular Formula | C20H20Cl2N4O3S2 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | O-ethyl [1-[(2,6-dichloropyrimidin-4-yl)amino]-5-(1,3-dioxoisoindol-2-yl)pentan-3-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CCNc1cc(Cl)nc(Cl)n1)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H20Cl2N4O3S2/c1-2-29-20(30)31-12(7-9-23-16-11-15(21)24-19(22)25-16)8-10-26-17(27)13-5-3-4-6-14(13)18(26)28/h3-6,11-12H,2,7-10H2,1H3,(H,23,24,25) |
| InChIKey | DVIJJTZFLOREDJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|