C17H19NO6S — CID 102525016
methyl 5-(1,3-dioxoisoindol-2-yl)-4-ethoxycarbonylsulfanylpentanoate (PubChem CID 102525016) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is methyl 5-(1,3-dioxoisoindol-2-yl)-4-ethoxycarbonylsulfanylpentanoate.
| Compound Name | methyl 5-(1,3-dioxoisoindol-2-yl)-4-ethoxycarbonylsulfanylpentanoate |
|---|---|
| PubChem CID | 102525016 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | methyl 5-(1,3-dioxoisoindol-2-yl)-4-ethoxycarbonylsulfanylpentanoate |
| SMILES | CCOC(=O)SC(CCC(=O)OC)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H19NO6S/c1-3-24-17(22)25-11(8-9-14(19)23-2)10-18-15(20)12-6-4-5-7-13(12)16(18)21/h4-7,11H,3,8-10H2,1-2H3 |
| InChIKey | GAKQAGXZPDGXAP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|