C22H30N2O5S2 — CID 102394912
O-ethyl [1-(1,3-dioxoisoindol-2-yl)-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl]sulfanylmethanethioate (PubChem CID 102394912) has the molecular formula C22H30N2O5S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is O-ethyl [1-(1,3-dioxoisoindol-2-yl)-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [1-(1,3-dioxoisoindol-2-yl)-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 102394912 |
| Molecular Formula | C22H30N2O5S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | O-ethyl [1-(1,3-dioxoisoindol-2-yl)-4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CCN1C(=O)c2ccccc2C1=O)C(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N2O5S2/c1-7-28-20(30)31-16(22(5,6)23-19(27)29-21(2,3)4)12-13-24-17(25)14-10-8-9-11-15(14)18(24)26/h8-11,16H,7,12-13H2,1-6H3,(H,23,27) |
| InChIKey | OVMJJRVVGCWUPZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|