C19H20BrN3O4S — CID 166108068
tert-butyl N-[1-(4-bromo-1,3-thiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propyl]carbamate (PubChem CID 166108068) has the molecular formula C19H20BrN3O4S and a molecular weight of 466.36 g/mol. Its IUPAC name is tert-butyl N-[1-(4-bromo-1,3-thiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-bromo-1,3-thiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 166108068 |
| Molecular Formula | C19H20BrN3O4S |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | tert-butyl N-[1-(4-bromo-1,3-thiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCN1C(=O)c2ccccc2C1=O)c1nc(Br)cs1 |
| InChI | InChI=1S/C19H20BrN3O4S/c1-19(2,3)27-18(26)21-13(15-22-14(20)10-28-15)8-9-23-16(24)11-6-4-5-7-12(11)17(23)25/h4-7,10,13H,8-9H2,1-3H3,(H,21,26) |
| InChIKey | ZVAHFWUSGKTBHX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|