C21H20Cl2N4O4S2 — CID 135032261
O-ethyl [1-[acetyl-(4,6-dichloropyrimidin-2-yl)amino]-4-(1,3-dioxoisoindol-2-yl)butan-2-yl]sulfanylmethanethioate (PubChem CID 135032261) has the molecular formula C21H20Cl2N4O4S2 and a molecular weight of 527.46 g/mol. Its IUPAC name is O-ethyl [1-[acetyl-(4,6-dichloropyrimidin-2-yl)amino]-4-(1,3-dioxoisoindol-2-yl)butan-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [1-[acetyl-(4,6-dichloropyrimidin-2-yl)amino]-4-(1,3-dioxoisoindol-2-yl)butan-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 135032261 |
| Molecular Formula | C21H20Cl2N4O4S2 |
| Molecular Weight | 527.46 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | O-ethyl [1-[acetyl-(4,6-dichloropyrimidin-2-yl)amino]-4-(1,3-dioxoisoindol-2-yl)butan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CCN1C(=O)c2ccccc2C1=O)CN(C(C)=O)c1nc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C21H20Cl2N4O4S2/c1-3-31-21(32)33-13(11-27(12(2)28)20-24-16(22)10-17(23)25-20)8-9-26-18(29)14-6-4-5-7-15(14)19(26)30/h4-7,10,13H,3,8-9,11H2,1-2H3 |
| InChIKey | FTEWKUAINUNCNZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|