C25H37BrClNO8 — CID 142409291
diethyl 2-[3-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]propyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate (PubChem CID 142409291) has the molecular formula C25H37BrClNO8 and a molecular weight of 594.93 g/mol. Its IUPAC name is diethyl 2-[3-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]propyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate.
| Compound Name | diethyl 2-[3-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]propyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
|---|---|
| PubChem CID | 142409291 |
| Molecular Formula | C25H37BrClNO8 |
| Molecular Weight | 594.93 g/mol |
| Exact Mass | 593.14 |
| IUPAC Name | diethyl 2-[3-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]propyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanedioate |
| SMILES | CCOC(=O)C(CCCc1cc(OCCCOC)c(Cl)cc1Br)(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C25H37BrClNO8/c1-7-33-21(29)25(22(30)34-8-2,28-23(31)36-24(3,4)5)12-9-11-17-15-20(19(27)16-18(17)26)35-14-10-13-32-6/h15-16H,7-14H2,1-6H3,(H,28,31) |
| InChIKey | ZHIVXNIBMZJPMJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.93 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|