C19H29BrClNO3 — CID 67287255
tert-butyl N-[(3S)-1-(4-bromo-2-chlorophenyl)-3-(hydroxymethyl)heptan-3-yl]carbamate (PubChem CID 67287255) has the molecular formula C19H29BrClNO3 and a molecular weight of 434.80 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(4-bromo-2-chlorophenyl)-3-(hydroxymethyl)heptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(4-bromo-2-chlorophenyl)-3-(hydroxymethyl)heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 67287255 |
| Molecular Formula | C19H29BrClNO3 |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | tert-butyl N-[(3S)-1-(4-bromo-2-chlorophenyl)-3-(hydroxymethyl)heptan-3-yl]carbamate |
| SMILES | CCCC[C@@](CO)(CCc1ccc(Br)cc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29BrClNO3/c1-5-6-10-19(13-23,22-17(24)25-18(2,3)4)11-9-14-7-8-15(20)12-16(14)21/h7-8,12,23H,5-6,9-11,13H2,1-4H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | SGQDWWBGCJFEPT-IBGZPJMESA-N |
| XLogP | 5.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |