C16H23BrClNO3 — CID 67286977
tert-butyl N-[(2S)-4-(4-bromo-2-chlorophenyl)-1-hydroxy-2-methylbutan-2-yl]carbamate (PubChem CID 67286977) has the molecular formula C16H23BrClNO3 and a molecular weight of 392.72 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-(4-bromo-2-chlorophenyl)-1-hydroxy-2-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-(4-bromo-2-chlorophenyl)-1-hydroxy-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67286977 |
| Molecular Formula | C16H23BrClNO3 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | tert-butyl N-[(2S)-4-(4-bromo-2-chlorophenyl)-1-hydroxy-2-methylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@](C)(CO)CCc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H23BrClNO3/c1-15(2,3)22-14(21)19-16(4,10-20)8-7-11-5-6-12(17)9-13(11)18/h5-6,9,20H,7-8,10H2,1-4H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | YJHQXYAISHPJGU-INIZCTEOSA-N |
| XLogP | 4.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |