C18H25BrClINO3+ — CID 163455342
2-(4-bromo-2-chlorophenyl)ethyl-[1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-en-2-yl]iodanium (PubChem CID 163455342) has the molecular formula C18H25BrClINO3+ and a molecular weight of 545.66 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)ethyl-[1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-en-2-yl]iodanium.
| Compound Name | 2-(4-bromo-2-chlorophenyl)ethyl-[1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-en-2-yl]iodanium |
|---|---|
| PubChem CID | 163455342 |
| Molecular Formula | C18H25BrClINO3+ |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 543.97 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)ethyl-[1-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-en-2-yl]iodanium |
| SMILES | C=CCC(CO)(NC(=O)OC(C)(C)C)[I+]CCc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C18H24BrClINO3/c1-5-9-18(12-23,22-16(24)25-17(2,3)4)21-10-8-13-6-7-14(19)11-15(13)20/h5-7,11,23H,1,8-10,12H2,2-4H3/p+1 |
| InChIKey | BJZDFVMZUVCINF-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|