C21H34FNO4 — CID 141084350
tert-butyl N-[(2R)-4-[2-(5-fluoropentoxy)phenyl]-1-hydroxy-2-methylbutan-2-yl]carbamate (PubChem CID 141084350) has the molecular formula C21H34FNO4 and a molecular weight of 383.50 g/mol. Its IUPAC name is tert-butyl N-[(2R)-4-[2-(5-fluoropentoxy)phenyl]-1-hydroxy-2-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-4-[2-(5-fluoropentoxy)phenyl]-1-hydroxy-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 141084350 |
| Molecular Formula | C21H34FNO4 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | tert-butyl N-[(2R)-4-[2-(5-fluoropentoxy)phenyl]-1-hydroxy-2-methylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@](C)(CO)CCc1ccccc1OCCCCCF |
| InChI | InChI=1S/C21H34FNO4/c1-20(2,3)27-19(25)23-21(4,16-24)13-12-17-10-6-7-11-18(17)26-15-9-5-8-14-22/h6-7,10-11,24H,5,8-9,12-16H2,1-4H3,(H,23,25)/t21-/m1/s1 |
| InChIKey | ZZOXOPIZJVLEMF-OAQYLSRUSA-N |
| XLogP | 4.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|