C21H25NO6S — CID 170987161
ethyl 4-(2-acetyloxy-6-phenyl-3-pyridinyl)-2-methyl-2-methylsulfonylbutanoate (PubChem CID 170987161) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is ethyl 4-(2-acetyloxy-6-phenyl-3-pyridinyl)-2-methyl-2-methylsulfonylbutanoate.
| Compound Name | ethyl 4-(2-acetyloxy-6-phenyl-3-pyridinyl)-2-methyl-2-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 170987161 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | ethyl 4-(2-acetyloxy-6-phenyl-3-pyridinyl)-2-methyl-2-methylsulfonylbutanoate |
| SMILES | CCOC(=O)C(C)(CCc1ccc(-c2ccccc2)nc1OC(C)=O)S(C)(=O)=O |
| InChI | InChI=1S/C21H25NO6S/c1-5-27-20(24)21(3,29(4,25)26)14-13-17-11-12-18(16-9-7-6-8-10-16)22-19(17)28-15(2)23/h6-12H,5,13-14H2,1-4H3 |
| InChIKey | BRVISERLJONFLU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |