C22H24N2O5S — CID 140814384
ethyl 2-methyl-2-methylsulfonyl-4-(4-oxo-7-phenylquinazolin-3-yl)butanoate (PubChem CID 140814384) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is ethyl 2-methyl-2-methylsulfonyl-4-(4-oxo-7-phenylquinazolin-3-yl)butanoate.
| Compound Name | ethyl 2-methyl-2-methylsulfonyl-4-(4-oxo-7-phenylquinazolin-3-yl)butanoate |
|---|---|
| PubChem CID | 140814384 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | ethyl 2-methyl-2-methylsulfonyl-4-(4-oxo-7-phenylquinazolin-3-yl)butanoate |
| SMILES | CCOC(=O)C(C)(CCn1cnc2cc(-c3ccccc3)ccc2c1=O)S(C)(=O)=O |
| InChI | InChI=1S/C22H24N2O5S/c1-4-29-21(26)22(2,30(3,27)28)12-13-24-15-23-19-14-17(10-11-18(19)20(24)25)16-8-6-5-7-9-16/h5-11,14-15H,4,12-13H2,1-3H3 |
| InChIKey | UWYMCKACMAFMAI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |