C25H30N4O6S — CID 118513641
N-hydroxy-2-methyl-2-methylsulfonyl-4-[7-[4-(morpholin-4-ylmethyl)phenyl]-4-oxoquinazolin-3-yl]butanamide (PubChem CID 118513641) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-methylsulfonyl-4-[7-[4-(morpholin-4-ylmethyl)phenyl]-4-oxoquinazolin-3-yl]butanamide.
| Compound Name | N-hydroxy-2-methyl-2-methylsulfonyl-4-[7-[4-(morpholin-4-ylmethyl)phenyl]-4-oxoquinazolin-3-yl]butanamide |
|---|---|
| PubChem CID | 118513641 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-hydroxy-2-methyl-2-methylsulfonyl-4-[7-[4-(morpholin-4-ylmethyl)phenyl]-4-oxoquinazolin-3-yl]butanamide |
| SMILES | CC(CCn1cnc2cc(-c3ccc(CN4CCOCC4)cc3)ccc2c1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C25H30N4O6S/c1-25(24(31)27-32,36(2,33)34)9-10-29-17-26-22-15-20(7-8-21(22)23(29)30)19-5-3-18(4-6-19)16-28-11-13-35-14-12-28/h3-8,15,17,32H,9-14,16H2,1-2H3,(H,27,31) |
| InChIKey | ZKMXOVPYDJMKFS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|