C27H33FN4O6S — CID 137359546
2-ethylsulfonyl-4-[7-[2-fluoro-4-(2-morpholin-4-ylethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methylbutanamide (PubChem CID 137359546) has the molecular formula C27H33FN4O6S and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-ethylsulfonyl-4-[7-[2-fluoro-4-(2-morpholin-4-ylethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methylbutanamide.
| Compound Name | 2-ethylsulfonyl-4-[7-[2-fluoro-4-(2-morpholin-4-ylethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methylbutanamide |
|---|---|
| PubChem CID | 137359546 |
| Molecular Formula | C27H33FN4O6S |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | 2-ethylsulfonyl-4-[7-[2-fluoro-4-(2-morpholin-4-ylethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methylbutanamide |
| SMILES | CCS(=O)(=O)C(C)(CCn1cnc2cc(-c3ccc(CCN4CCOCC4)cc3F)ccc2c1=O)C(=O)NO |
| InChI | InChI=1S/C27H33FN4O6S/c1-3-39(36,37)27(2,26(34)30-35)9-11-32-18-29-24-17-20(5-7-22(24)25(32)33)21-6-4-19(16-23(21)28)8-10-31-12-14-38-15-13-31/h4-7,16-18,35H,3,8-15H2,1-2H3,(H,30,34) |
| InChIKey | XGACPWKVRJCISE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|