C25H29FN4O5S — CID 160620475
(2S)-4-[7-[4-[[cyclopropyl(methyl)amino]methyl]-3-fluorophenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 160620475) has the molecular formula C25H29FN4O5S and a molecular weight of 516.60 g/mol. Its IUPAC name is (2S)-4-[7-[4-[[cyclopropyl(methyl)amino]methyl]-3-fluorophenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2S)-4-[7-[4-[[cyclopropyl(methyl)amino]methyl]-3-fluorophenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 160620475 |
| Molecular Formula | C25H29FN4O5S |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | (2S)-4-[7-[4-[[cyclopropyl(methyl)amino]methyl]-3-fluorophenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CN(Cc1ccc(-c2ccc3c(=O)n(CC[C@@](C)(C(=O)NO)S(C)(=O)=O)cnc3c2)cc1F)C1CC1 |
| InChI | InChI=1S/C25H29FN4O5S/c1-25(24(32)28-33,36(3,34)35)10-11-30-15-27-22-13-17(6-9-20(22)23(30)31)16-4-5-18(21(26)12-16)14-29(2)19-7-8-19/h4-6,9,12-13,15,19,33H,7-8,10-11,14H2,1-3H3,(H,28,32)/t25-/m0/s1 |
| InChIKey | RGQDGVPXVOQZCT-VWLOTQADSA-N |
| XLogP | 2.50 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|