C21H22FN3O6S — CID 157184889
(2S)-4-[5-fluoro-7-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 157184889) has the molecular formula C21H22FN3O6S and a molecular weight of 463.49 g/mol. Its IUPAC name is (2S)-4-[5-fluoro-7-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2S)-4-[5-fluoro-7-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 157184889 |
| Molecular Formula | C21H22FN3O6S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (2S)-4-[5-fluoro-7-(4-methoxyphenyl)-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | COc1ccc(-c2cc(F)c3c(=O)n(CC[C@@](C)(C(=O)NO)S(C)(=O)=O)cnc3c2)cc1 |
| InChI | InChI=1S/C21H22FN3O6S/c1-21(20(27)24-28,32(3,29)30)8-9-25-12-23-17-11-14(10-16(22)18(17)19(25)26)13-4-6-15(31-2)7-5-13/h4-7,10-12,28H,8-9H2,1-3H3,(H,24,27)/t21-/m0/s1 |
| InChIKey | AOZTZIQWVFYDRJ-NRFANRHFSA-N |
| XLogP | 1.91 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|