C25H27F2N3O5S — CID 158927434
(2R)-4-[7-[4-(2-cyclopropylethyl)-2-fluorophenyl]-6-fluoro-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 158927434) has the molecular formula C25H27F2N3O5S and a molecular weight of 519.57 g/mol. Its IUPAC name is (2R)-4-[7-[4-(2-cyclopropylethyl)-2-fluorophenyl]-6-fluoro-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[7-[4-(2-cyclopropylethyl)-2-fluorophenyl]-6-fluoro-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 158927434 |
| Molecular Formula | C25H27F2N3O5S |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (2R)-4-[7-[4-(2-cyclopropylethyl)-2-fluorophenyl]-6-fluoro-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCn1cnc2cc(-c3ccc(CCC4CC4)cc3F)c(F)cc2c1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C25H27F2N3O5S/c1-25(24(32)29-33,36(2,34)35)9-10-30-14-28-22-13-18(21(27)12-19(22)23(30)31)17-8-7-16(11-20(17)26)6-5-15-3-4-15/h7-8,11-15,33H,3-6,9-10H2,1-2H3,(H,29,32)/t25-/m1/s1 |
| InChIKey | JIPUKFMZAPPDKG-RUZDIDTESA-N |
| XLogP | 3.38 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|