C25H28F2N4O6S — CID 129217891
(2R)-4-[6-fluoro-7-[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129217891) has the molecular formula C25H28F2N4O6S and a molecular weight of 550.58 g/mol. Its IUPAC name is (2R)-4-[6-fluoro-7-[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[6-fluoro-7-[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129217891 |
| Molecular Formula | C25H28F2N4O6S |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | (2R)-4-[6-fluoro-7-[2-fluoro-4-(morpholin-4-ylmethyl)phenyl]-4-oxoquinazolin-3-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CCn1cnc2cc(-c3ccc(CN4CCOCC4)cc3F)c(F)cc2c1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C25H28F2N4O6S/c1-25(24(33)29-34,38(2,35)36)5-6-31-15-28-22-13-18(21(27)12-19(22)23(31)32)17-4-3-16(11-20(17)26)14-30-7-9-37-10-8-30/h3-4,11-13,15,34H,5-10,14H2,1-2H3,(H,29,33)/t25-/m1/s1 |
| InChIKey | SAKLMNTXMJATAZ-RUZDIDTESA-N |
| XLogP | 1.87 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|