C26H32FN4O6S+ — CID 163726105
[[(2R)-4-[6-fluoro-7-[4-(2-morpholin-4-ylethyl)phenyl]-4-oxoquinazolin-3-yl]-2-methyl-2-methylsulfonylbutanoyl]amino]oxidanium (PubChem CID 163726105) has the molecular formula C26H32FN4O6S+ and a molecular weight of 547.63 g/mol. Its IUPAC name is [[(2R)-4-[6-fluoro-7-[4-(2-morpholin-4-ylethyl)phenyl]-4-oxoquinazolin-3-yl]-2-methyl-2-methylsulfonylbutanoyl]amino]oxidanium.
| Compound Name | [[(2R)-4-[6-fluoro-7-[4-(2-morpholin-4-ylethyl)phenyl]-4-oxoquinazolin-3-yl]-2-methyl-2-methylsulfonylbutanoyl]amino]oxidanium |
|---|---|
| PubChem CID | 163726105 |
| Molecular Formula | C26H32FN4O6S+ |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | [[(2R)-4-[6-fluoro-7-[4-(2-morpholin-4-ylethyl)phenyl]-4-oxoquinazolin-3-yl]-2-methyl-2-methylsulfonylbutanoyl]amino]oxidanium |
| SMILES | C[C@@](CCn1cnc2cc(-c3ccc(CCN4CCOCC4)cc3)c(F)cc2c1=O)(C(=O)N[OH2+])S(C)(=O)=O |
| InChI | InChI=1S/C26H31FN4O6S/c1-26(25(33)29-34,38(2,35)36)8-10-31-17-28-23-16-20(22(27)15-21(23)24(31)32)19-5-3-18(4-6-19)7-9-30-11-13-37-14-12-30/h3-6,15-17,34H,7-14H2,1-2H3,(H,29,33)/p+1/t26-/m1/s1 |
| InChIKey | KVRVZRAQMNYMIZ-AREMUKBSSA-O |
| XLogP | 1.03 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|