C13H19NO6S — CID 67248478
ethyl 4-(4-hydroxy-2-oxo-1-pyridinyl)-2-methyl-2-methylsulfonylbutanoate (PubChem CID 67248478) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is ethyl 4-(4-hydroxy-2-oxo-1-pyridinyl)-2-methyl-2-methylsulfonylbutanoate.
| Compound Name | ethyl 4-(4-hydroxy-2-oxo-1-pyridinyl)-2-methyl-2-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 67248478 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | ethyl 4-(4-hydroxy-2-oxo-1-pyridinyl)-2-methyl-2-methylsulfonylbutanoate |
| SMILES | CCOC(=O)C(C)(CCn1ccc(O)cc1=O)S(C)(=O)=O |
| InChI | InChI=1S/C13H19NO6S/c1-4-20-12(17)13(2,21(3,18)19)6-8-14-7-5-10(15)9-11(14)16/h5,7,9,15H,4,6,8H2,1-3H3 |
| InChIKey | VBHUMEWXBZEHHL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |