About 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate
1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate (PubChem CID 90712601) has the molecular formula C12H14BrNO4
and a molecular weight of 316.15 g/mol. Its IUPAC name is 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate.
Molecular Properties
| Compound Name | 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate |
| PubChem CID | 90712601 |
| Molecular Formula | C12H14BrNO4 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate |
| SMILES | COC(=O)C(C)(C)C(=O)OCc1ccc(Br)nc1 |
| InChI | InChI=1S/C12H14BrNO4/c1-12(2,10(15)17-3)11(16)18-7-8-4-5-9(13)14-6-8/h4-6H,7H2,1-3H3 |
| InChIKey | GPWSAMLEOVOAKQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate?
The IUPAC name of 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate (CID 90712601) is 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate.
What is the SMILES notation for 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate?
The canonical SMILES for 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate is COC(=O)C(C)(C)C(=O)OCc1ccc(Br)nc1.
What is the InChIKey of 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate?
The InChIKey is GPWSAMLEOVOAKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO4/c1-12(2,10(15)17-3)11(16)18-7-8-4-5-9(13)14-6-8/h4-6H,7H2,1-3H3.
What are the key properties of 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate?
1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate has a molecular weight of 316.15 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(6-bromo-3-pyridinyl)methyl] 3-O-methyl 2,2-dimethylpropanedioate is sourced from PubChem (CID 90712601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).