C19H22O4S2 — CID 56951132
methyl (2R)-2-methyl-2-methylsulfonyl-4-(4-phenylsulfanylphenyl)butanoate (PubChem CID 56951132) has the molecular formula C19H22O4S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is methyl (2R)-2-methyl-2-methylsulfonyl-4-(4-phenylsulfanylphenyl)butanoate.
| Compound Name | methyl (2R)-2-methyl-2-methylsulfonyl-4-(4-phenylsulfanylphenyl)butanoate |
|---|---|
| PubChem CID | 56951132 |
| Molecular Formula | C19H22O4S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | methyl (2R)-2-methyl-2-methylsulfonyl-4-(4-phenylsulfanylphenyl)butanoate |
| SMILES | COC(=O)[C@@](C)(CCc1ccc(Sc2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H22O4S2/c1-19(18(20)23-2,25(3,21)22)14-13-15-9-11-17(12-10-15)24-16-7-5-4-6-8-16/h4-12H,13-14H2,1-3H3/t19-/m1/s1 |
| InChIKey | HQUVOOGVFDIDOJ-LJQANCHMSA-N |
| XLogP | 3.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |