C22H28O3S — CID 121480280
3-methyl-3-methylsulfonyl-8-(4-phenylphenyl)octan-2-one (PubChem CID 121480280) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is 3-methyl-3-methylsulfonyl-8-(4-phenylphenyl)octan-2-one.
| Compound Name | 3-methyl-3-methylsulfonyl-8-(4-phenylphenyl)octan-2-one |
|---|---|
| PubChem CID | 121480280 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-methyl-3-methylsulfonyl-8-(4-phenylphenyl)octan-2-one |
| SMILES | CC(=O)C(C)(CCCCCc1ccc(-c2ccccc2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H28O3S/c1-18(23)22(2,26(3,24)25)17-9-5-6-10-19-13-15-21(16-14-19)20-11-7-4-8-12-20/h4,7-8,11-16H,5-6,9-10,17H2,1-3H3 |
| InChIKey | AIWBBMZWORLHMD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|