C24H36NO3S+ — CID 11796239
dimethyl-[6-(4-phenylphenyl)hexyl]-(4-sulfobutyl)azanium (PubChem CID 11796239) has the molecular formula C24H36NO3S+ and a molecular weight of 418.62 g/mol. Its IUPAC name is dimethyl-[6-(4-phenylphenyl)hexyl]-(4-sulfobutyl)azanium.
| Compound Name | dimethyl-[6-(4-phenylphenyl)hexyl]-(4-sulfobutyl)azanium |
|---|---|
| PubChem CID | 11796239 |
| Molecular Formula | C24H36NO3S+ |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | dimethyl-[6-(4-phenylphenyl)hexyl]-(4-sulfobutyl)azanium |
| SMILES | C[N+](C)(CCCCCCc1ccc(-c2ccccc2)cc1)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C24H35NO3S/c1-25(2,20-10-11-21-29(26,27)28)19-9-4-3-6-12-22-15-17-24(18-16-22)23-13-7-5-8-14-23/h5,7-8,13-18H,3-4,6,9-12,19-21H2,1-2H3/p+1 |
| InChIKey | DUTNGMDPJWBUAI-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|