C28H52N2O6S2 — CID 10674696
4-[[2-[[dimethyl(4-sulfonatobutyl)azaniumyl]methyl]-9-phenylnonyl]-dimethylazaniumyl]butane-1-sulfonate (PubChem CID 10674696) has the molecular formula C28H52N2O6S2 and a molecular weight of 576.87 g/mol. Its IUPAC name is 4-[[2-[[dimethyl(4-sulfonatobutyl)azaniumyl]methyl]-9-phenylnonyl]-dimethylazaniumyl]butane-1-sulfonate.
| Compound Name | 4-[[2-[[dimethyl(4-sulfonatobutyl)azaniumyl]methyl]-9-phenylnonyl]-dimethylazaniumyl]butane-1-sulfonate |
|---|---|
| PubChem CID | 10674696 |
| Molecular Formula | C28H52N2O6S2 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | 4-[[2-[[dimethyl(4-sulfonatobutyl)azaniumyl]methyl]-9-phenylnonyl]-dimethylazaniumyl]butane-1-sulfonate |
| SMILES | C[N+](C)(CCCCS(=O)(=O)[O-])CC(CCCCCCCc1ccccc1)C[N+](C)(C)CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C28H52N2O6S2/c1-29(2,21-13-15-23-37(31,32)33)25-28(26-30(3,4)22-14-16-24-38(34,35)36)20-10-7-5-6-9-17-27-18-11-8-12-19-27/h8,11-12,18-19,28H,5-7,9-10,13-17,20-26H2,1-4H3 |
| InChIKey | HLLIPXLNRDZIRT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|