C14H23NO — CID 18702344
N,N-dimethyl-6-phenylhexan-1-amine oxide (PubChem CID 18702344) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N,N-dimethyl-6-phenylhexan-1-amine oxide.
| Compound Name | N,N-dimethyl-6-phenylhexan-1-amine oxide |
|---|---|
| PubChem CID | 18702344 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N,N-dimethyl-6-phenylhexan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCCCCc1ccccc1 |
| InChI | InChI=1S/C14H23NO/c1-15(2,16)13-9-4-3-6-10-14-11-7-5-8-12-14/h5,7-8,11-12H,3-4,6,9-10,13H2,1-2H3 |
| InChIKey | RXESHNKWUHNRKN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|