C23H37NO3S — CID 10692790
4-[[(2E,6E)-3,7-dimethyl-9-phenylnona-2,6-dienyl]-dimethylazaniumyl]butane-1-sulfonate (PubChem CID 10692790) has the molecular formula C23H37NO3S and a molecular weight of 407.62 g/mol. Its IUPAC name is 4-[[(2E,6E)-3,7-dimethyl-9-phenylnona-2,6-dienyl]-dimethylazaniumyl]butane-1-sulfonate.
| Compound Name | 4-[[(2E,6E)-3,7-dimethyl-9-phenylnona-2,6-dienyl]-dimethylazaniumyl]butane-1-sulfonate |
|---|---|
| PubChem CID | 10692790 |
| Molecular Formula | C23H37NO3S |
| Molecular Weight | 407.62 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 4-[[(2E,6E)-3,7-dimethyl-9-phenylnona-2,6-dienyl]-dimethylazaniumyl]butane-1-sulfonate |
| SMILES | C/C(=C\C[N+](C)(C)CCCCS(=O)(=O)[O-])CC/C=C(\C)CCc1ccccc1 |
| InChI | InChI=1S/C23H37NO3S/c1-21(15-16-23-13-6-5-7-14-23)11-10-12-22(2)17-19-24(3,4)18-8-9-20-28(25,26)27/h5-7,11,13-14,17H,8-10,12,15-16,18-20H2,1-4H3/b21-11+,22-17+ |
| InChIKey | HPCOCZKYOKIDAG-CZYWBIRRSA-N |
| XLogP | 4.69 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|