C20H37NO4S — CID 10667958
4-[dimethyl-[(2E,6E)-3,7,10-trimethylundeca-2,6,9-trienyl]azaniumyl]-2-hydroxybutane-1-sulfonate (PubChem CID 10667958) has the molecular formula C20H37NO4S and a molecular weight of 387.59 g/mol. Its IUPAC name is 4-[dimethyl-[(2E,6E)-3,7,10-trimethylundeca-2,6,9-trienyl]azaniumyl]-2-hydroxybutane-1-sulfonate.
| Compound Name | 4-[dimethyl-[(2E,6E)-3,7,10-trimethylundeca-2,6,9-trienyl]azaniumyl]-2-hydroxybutane-1-sulfonate |
|---|---|
| PubChem CID | 10667958 |
| Molecular Formula | C20H37NO4S |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 4-[dimethyl-[(2E,6E)-3,7,10-trimethylundeca-2,6,9-trienyl]azaniumyl]-2-hydroxybutane-1-sulfonate |
| SMILES | CC(C)=CC/C(C)=C/CC/C(C)=C/C[N+](C)(C)CCC(O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C20H37NO4S/c1-17(2)10-11-18(3)8-7-9-19(4)12-14-21(5,6)15-13-20(22)16-26(23,24)25/h8,10,12,20,22H,7,9,11,13-16H2,1-6H3/b18-8+,19-12+ |
| InChIKey | KUMFZVYOEXCLIX-BBHLRKQCSA-N |
| XLogP | 3.39 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|