About 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid
4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid (PubChem CID 71005818) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid |
| PubChem CID | 71005818 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C#C[C@H]2C[C@@H]2CO)cc1 |
| InChI | InChI=1S/C13H12O3/c14-8-12-7-11(12)6-3-9-1-4-10(5-2-9)13(15)16/h1-2,4-5,11-12,14H,7-8H2,(H,15,16)/t11-,12+/m0/s1 |
| InChIKey | CVJZNMZZYJLMAR-NWDGAFQWSA-N |
| XLogP | 1.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid?
The IUPAC name of 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid (CID 71005818) is 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid.
What is the SMILES notation for 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid?
The canonical SMILES for 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid is O=C(O)c1ccc(C#C[C@H]2C[C@@H]2CO)cc1.
What is the InChIKey of 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid?
The InChIKey is CVJZNMZZYJLMAR-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H12O3/c14-8-12-7-11(12)6-3-9-1-4-10(5-2-9)13(15)16/h1-2,4-5,11-12,14H,7-8H2,(H,15,16)/t11-,12+/m0/s1.
What are the key properties of 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid?
4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid has a molecular weight of 216.24 g/mol, XLogP of 1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]ethynyl]benzoic acid is sourced from PubChem (CID 71005818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).