4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid

C18H18O3 — CID 89158469

IUPAC4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid
SMILESO=C(O)c1ccc(C#CC#CC2CCC(CO)CC2)cc1
InChIInChI=1S/C18H18O3/c19-13-16-7-5-14(6-8-16)3-1-2-4-15-9-11-17(12-10-15)18(20)21/h9-12,14,16,19H,5-8,13H2,(H,20,21)
InChIKeyIHVCFWXDQZYDTB-UHFFFAOYSA-N
MW282.34 g/mol
LogP2.54
Rot. Bonds2

About 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid

4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid (PubChem CID 89158469) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid.

Molecular Properties

Compound Name4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid
PubChem CID89158469
Molecular FormulaC18H18O3
Molecular Weight282.34 g/mol
Exact Mass282.13
IUPAC Name4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid
SMILESO=C(O)c1ccc(C#CC#CC2CCC(CO)CC2)cc1
InChIInChI=1S/C18H18O3/c19-13-16-7-5-14(6-8-16)3-1-2-4-15-9-11-17(12-10-15)18(20)21/h9-12,14,16,19H,5-8,13H2,(H,20,21)
InChIKeyIHVCFWXDQZYDTB-UHFFFAOYSA-N
XLogP2.54
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.34
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid?
The IUPAC name of 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid (CID 89158469) is 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid.
What is the SMILES notation for 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid?
The canonical SMILES for 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid is O=C(O)c1ccc(C#CC#CC2CCC(CO)CC2)cc1.
What is the InChIKey of 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid?
The InChIKey is IHVCFWXDQZYDTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c19-13-16-7-5-14(6-8-16)3-1-2-4-15-9-11-17(12-10-15)18(20)21/h9-12,14,16,19H,5-8,13H2,(H,20,21).
What are the key properties of 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid?
4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid has a molecular weight of 282.34 g/mol, XLogP of 2.54, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-(hydroxymethyl)cyclohexyl]buta-1,3-diynyl]benzoic acid is sourced from PubChem (CID 89158469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).