C20H22F2N2O3 — CID 121481444
4,4-difluoro-N,3-dihydroxy-3-methyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enyl]amino]butanamide (PubChem CID 121481444) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is 4,4-difluoro-N,3-dihydroxy-3-methyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enyl]amino]butanamide.
| Compound Name | 4,4-difluoro-N,3-dihydroxy-3-methyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enyl]amino]butanamide |
|---|---|
| PubChem CID | 121481444 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4,4-difluoro-N,3-dihydroxy-3-methyl-2-[[(E)-3-(4-phenylphenyl)prop-2-enyl]amino]butanamide |
| SMILES | CC(O)(C(F)F)C(NC/C=C/c1ccc(-c2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H22F2N2O3/c1-20(26,19(21)22)17(18(25)24-27)23-13-5-6-14-9-11-16(12-10-14)15-7-3-2-4-8-15/h2-12,17,19,23,26-27H,13H2,1H3,(H,24,25)/b6-5+ |
| InChIKey | KGXPOQKNHDBGHP-AATRIKPKSA-N |
| XLogP | 2.85 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|