C23H23F2NO3 — CID 162056804
4,4-difluoro-N,3-dihydroxy-3-methyl-2-[2-(6-phenylnaphthalen-2-yl)ethyl]butanamide (PubChem CID 162056804) has the molecular formula C23H23F2NO3 and a molecular weight of 399.44 g/mol. Its IUPAC name is 4,4-difluoro-N,3-dihydroxy-3-methyl-2-[2-(6-phenylnaphthalen-2-yl)ethyl]butanamide.
| Compound Name | 4,4-difluoro-N,3-dihydroxy-3-methyl-2-[2-(6-phenylnaphthalen-2-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 162056804 |
| Molecular Formula | C23H23F2NO3 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4,4-difluoro-N,3-dihydroxy-3-methyl-2-[2-(6-phenylnaphthalen-2-yl)ethyl]butanamide |
| SMILES | CC(O)(C(F)F)C(CCc1ccc2cc(-c3ccccc3)ccc2c1)C(=O)NO |
| InChI | InChI=1S/C23H23F2NO3/c1-23(28,22(24)25)20(21(27)26-29)12-8-15-7-9-19-14-18(11-10-17(19)13-15)16-5-3-2-4-6-16/h2-7,9-11,13-14,20,22,28-29H,8,12H2,1H3,(H,26,27) |
| InChIKey | YZHHRQHHWAAKMV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|