C19H22F2N2O4 — CID 121480189
(2S,3S)-4,4-difluoro-N,3-dihydroxy-2-[(2-methoxy-4-phenylphenyl)methylamino]-3-methylbutanamide (PubChem CID 121480189) has the molecular formula C19H22F2N2O4 and a molecular weight of 380.39 g/mol. Its IUPAC name is (2S,3S)-4,4-difluoro-N,3-dihydroxy-2-[(2-methoxy-4-phenylphenyl)methylamino]-3-methylbutanamide.
| Compound Name | (2S,3S)-4,4-difluoro-N,3-dihydroxy-2-[(2-methoxy-4-phenylphenyl)methylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 121480189 |
| Molecular Formula | C19H22F2N2O4 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2S,3S)-4,4-difluoro-N,3-dihydroxy-2-[(2-methoxy-4-phenylphenyl)methylamino]-3-methylbutanamide |
| SMILES | COc1cc(-c2ccccc2)ccc1CN[C@H](C(=O)NO)[C@](C)(O)C(F)F |
| InChI | InChI=1S/C19H22F2N2O4/c1-19(25,18(20)21)16(17(24)23-26)22-11-14-9-8-13(10-15(14)27-2)12-6-4-3-5-7-12/h3-10,16,18,22,25-26H,11H2,1-2H3,(H,23,24)/t16-,19+/m1/s1 |
| InChIKey | ACPYXSDJOWJLDL-APWZRJJASA-N |
| XLogP | 2.34 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|