C21H28N2O5 — CID 21345614
(5R)-N',2-dihydroxy-5-[(2S)-2-hydroxy-4-naphthalen-2-ylbutyl]-2-methylhexanediamide (PubChem CID 21345614) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is (5R)-N',2-dihydroxy-5-[(2S)-2-hydroxy-4-naphthalen-2-ylbutyl]-2-methylhexanediamide.
| Compound Name | (5R)-N',2-dihydroxy-5-[(2S)-2-hydroxy-4-naphthalen-2-ylbutyl]-2-methylhexanediamide |
|---|---|
| PubChem CID | 21345614 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (5R)-N',2-dihydroxy-5-[(2S)-2-hydroxy-4-naphthalen-2-ylbutyl]-2-methylhexanediamide |
| SMILES | CC(O)(CC[C@H](C[C@@H](O)CCc1ccc2ccccc2c1)C(=O)NO)C(N)=O |
| InChI | InChI=1S/C21H28N2O5/c1-21(27,20(22)26)11-10-17(19(25)23-28)13-18(24)9-7-14-6-8-15-4-2-3-5-16(15)12-14/h2-6,8,12,17-18,24,27-28H,7,9-11,13H2,1H3,(H2,22,26)(H,23,25)/t17-,18+,21?/m1/s1 |
| InChIKey | AAFZNDNZWBYIKG-IZKAZRHKSA-N |
| XLogP | 1.66 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|