C18H24F4N2O4 — CID 22452343
2-fluoro-5-[2-hydroxy-4-[3-(trifluoromethoxy)phenyl]butyl]-2-methylhexanediamide (PubChem CID 22452343) has the molecular formula C18H24F4N2O4 and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-fluoro-5-[2-hydroxy-4-[3-(trifluoromethoxy)phenyl]butyl]-2-methylhexanediamide.
| Compound Name | 2-fluoro-5-[2-hydroxy-4-[3-(trifluoromethoxy)phenyl]butyl]-2-methylhexanediamide |
|---|---|
| PubChem CID | 22452343 |
| Molecular Formula | C18H24F4N2O4 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-fluoro-5-[2-hydroxy-4-[3-(trifluoromethoxy)phenyl]butyl]-2-methylhexanediamide |
| SMILES | CC(F)(CCC(CC(O)CCc1cccc(OC(F)(F)F)c1)C(N)=O)C(N)=O |
| InChI | InChI=1S/C18H24F4N2O4/c1-17(19,16(24)27)8-7-12(15(23)26)10-13(25)6-5-11-3-2-4-14(9-11)28-18(20,21)22/h2-4,9,12-13,25H,5-8,10H2,1H3,(H2,23,26)(H2,24,27) |
| InChIKey | UNKDAARNFFBOQW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |