C17H27FN2O4S — CID 173243874
(5R,7S)-2-fluoro-7-hydroxy-2-methyl-5-(methylsulfamoyl)-9-phenylnonanamide (PubChem CID 173243874) has the molecular formula C17H27FN2O4S and a molecular weight of 374.48 g/mol. Its IUPAC name is (5R,7S)-2-fluoro-7-hydroxy-2-methyl-5-(methylsulfamoyl)-9-phenylnonanamide.
| Compound Name | (5R,7S)-2-fluoro-7-hydroxy-2-methyl-5-(methylsulfamoyl)-9-phenylnonanamide |
|---|---|
| PubChem CID | 173243874 |
| Molecular Formula | C17H27FN2O4S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (5R,7S)-2-fluoro-7-hydroxy-2-methyl-5-(methylsulfamoyl)-9-phenylnonanamide |
| SMILES | CNS(=O)(=O)C(CCC(C)(F)C(N)=O)C[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C17H27FN2O4S/c1-17(18,16(19)22)11-10-15(25(23,24)20-2)12-14(21)9-8-13-6-4-3-5-7-13/h3-7,14-15,20-21H,8-12H2,1-2H3,(H2,19,22)/t14-,15?,17?/m0/s1 |
| InChIKey | NIBLYYFCJPFQKF-UQPPLGOBSA-N |
| XLogP | 1.28 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |