C16H26N2O5S — CID 20577858
(5R,7S)-2,7-dihydroxy-2-methyl-9-phenyl-5-sulfamoylnonanamide (PubChem CID 20577858) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is (5R,7S)-2,7-dihydroxy-2-methyl-9-phenyl-5-sulfamoylnonanamide.
| Compound Name | (5R,7S)-2,7-dihydroxy-2-methyl-9-phenyl-5-sulfamoylnonanamide |
|---|---|
| PubChem CID | 20577858 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (5R,7S)-2,7-dihydroxy-2-methyl-9-phenyl-5-sulfamoylnonanamide |
| SMILES | CC(O)(CCC(C[C@@H](O)CCc1ccccc1)S(N)(=O)=O)C(N)=O |
| InChI | InChI=1S/C16H26N2O5S/c1-16(21,15(17)20)10-9-14(24(18,22)23)11-13(19)8-7-12-5-3-2-4-6-12/h2-6,13-14,19,21H,7-11H2,1H3,(H2,17,20)(H2,18,22,23)/t13-,14?,16?/m0/s1 |
| InChIKey | XIJUEPKTQROXGA-HLIUYOAVSA-N |
| XLogP | 0.04 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |