About 4-phenylbutan-2-yl sulfamate
4-phenylbutan-2-yl sulfamate (PubChem CID 24761702) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is 4-phenylbutan-2-yl sulfamate.
Molecular Properties
| Compound Name | 4-phenylbutan-2-yl sulfamate |
| PubChem CID | 24761702 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 4-phenylbutan-2-yl sulfamate |
| SMILES | CC(CCc1ccccc1)OS(N)(=O)=O |
| InChI | InChI=1S/C10H15NO3S/c1-9(14-15(11,12)13)7-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H2,11,12,13) |
| InChIKey | XXPKMBMSYZNATL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenylbutan-2-yl sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbutan-2-yl sulfamate?
The IUPAC name of 4-phenylbutan-2-yl sulfamate (CID 24761702) is 4-phenylbutan-2-yl sulfamate.
What is the SMILES notation for 4-phenylbutan-2-yl sulfamate?
The canonical SMILES for 4-phenylbutan-2-yl sulfamate is CC(CCc1ccccc1)OS(N)(=O)=O.
What is the InChIKey of 4-phenylbutan-2-yl sulfamate?
The InChIKey is XXPKMBMSYZNATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-9(14-15(11,12)13)7-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H2,11,12,13).
What are the key properties of 4-phenylbutan-2-yl sulfamate?
4-phenylbutan-2-yl sulfamate has a molecular weight of 229.30 g/mol, XLogP of 1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbutan-2-yl sulfamate is sourced from PubChem (CID 24761702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).