C17H25FN2O4 — CID 10315202
(5R)-5-[(2S)-4-(3-fluorophenyl)-2-hydroxybutyl]-2-hydroxy-2-methylhexanediamide (PubChem CID 10315202) has the molecular formula C17H25FN2O4 and a molecular weight of 340.40 g/mol. Its IUPAC name is (5R)-5-[(2S)-4-(3-fluorophenyl)-2-hydroxybutyl]-2-hydroxy-2-methylhexanediamide.
| Compound Name | (5R)-5-[(2S)-4-(3-fluorophenyl)-2-hydroxybutyl]-2-hydroxy-2-methylhexanediamide |
|---|---|
| PubChem CID | 10315202 |
| Molecular Formula | C17H25FN2O4 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (5R)-5-[(2S)-4-(3-fluorophenyl)-2-hydroxybutyl]-2-hydroxy-2-methylhexanediamide |
| SMILES | CC(O)(CC[C@H](C[C@@H](O)CCc1cccc(F)c1)C(N)=O)C(N)=O |
| InChI | InChI=1S/C17H25FN2O4/c1-17(24,16(20)23)8-7-12(15(19)22)10-14(21)6-5-11-3-2-4-13(18)9-11/h2-4,9,12,14,21,24H,5-8,10H2,1H3,(H2,19,22)(H2,20,23)/t12-,14+,17?/m1/s1 |
| InChIKey | YVCDYMCPCUVNBS-KMMYHCRNSA-N |
| XLogP | 0.63 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |