C21H24F2N2O — CID 144791715
N-[5,5-difluoro-4-methyl-3-[[(E)-3-(4-phenylphenyl)prop-2-enyl]amino]pent-1-en-2-yl]hydroxylamine (PubChem CID 144791715) has the molecular formula C21H24F2N2O and a molecular weight of 358.43 g/mol. Its IUPAC name is N-[5,5-difluoro-4-methyl-3-[[(E)-3-(4-phenylphenyl)prop-2-enyl]amino]pent-1-en-2-yl]hydroxylamine.
| Compound Name | N-[5,5-difluoro-4-methyl-3-[[(E)-3-(4-phenylphenyl)prop-2-enyl]amino]pent-1-en-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 144791715 |
| Molecular Formula | C21H24F2N2O |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[5,5-difluoro-4-methyl-3-[[(E)-3-(4-phenylphenyl)prop-2-enyl]amino]pent-1-en-2-yl]hydroxylamine |
| SMILES | C=C(NO)C(NC/C=C/c1ccc(-c2ccccc2)cc1)C(C)C(F)F |
| InChI | InChI=1S/C21H24F2N2O/c1-15(21(22)23)20(16(2)25-26)24-14-6-7-17-10-12-19(13-11-17)18-8-4-3-5-9-18/h3-13,15,20-21,24-26H,2,14H2,1H3/b7-6+ |
| InChIKey | AVDAPFCLUFEPPQ-VOTSOKGWSA-N |
| XLogP | 4.72 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|