C23H29FN2O4 — CID 144791734
(2S,3S)-4-fluoro-N,3-dihydroxy-2-[[(E)-3-[4-(3-methoxyphenyl)phenyl]prop-2-enyl]amino]-2,3-dimethylpentanamide (PubChem CID 144791734) has the molecular formula C23H29FN2O4 and a molecular weight of 416.49 g/mol. Its IUPAC name is (2S,3S)-4-fluoro-N,3-dihydroxy-2-[[(E)-3-[4-(3-methoxyphenyl)phenyl]prop-2-enyl]amino]-2,3-dimethylpentanamide.
| Compound Name | (2S,3S)-4-fluoro-N,3-dihydroxy-2-[[(E)-3-[4-(3-methoxyphenyl)phenyl]prop-2-enyl]amino]-2,3-dimethylpentanamide |
|---|---|
| PubChem CID | 144791734 |
| Molecular Formula | C23H29FN2O4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (2S,3S)-4-fluoro-N,3-dihydroxy-2-[[(E)-3-[4-(3-methoxyphenyl)phenyl]prop-2-enyl]amino]-2,3-dimethylpentanamide |
| SMILES | COc1cccc(-c2ccc(/C=C/CN[C@](C)(C(=O)NO)[C@](C)(O)C(C)F)cc2)c1 |
| InChI | InChI=1S/C23H29FN2O4/c1-16(24)23(3,28)22(2,21(27)26-29)25-14-6-7-17-10-12-18(13-11-17)19-8-5-9-20(15-19)30-4/h5-13,15-16,25,28-29H,14H2,1-4H3,(H,26,27)/b7-6+/t16?,22-,23-/m1/s1 |
| InChIKey | AAYKCBBHIFJCHG-VGWXEWALSA-N |
| XLogP | 3.34 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|