C17H12BrF2N — CID 106263071
N-[(3-bromo-2,6-difluorophenyl)methyl]naphthalen-1-amine (PubChem CID 106263071) has the molecular formula C17H12BrF2N and a molecular weight of 348.19 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]naphthalen-1-amine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 106263071 |
| Molecular Formula | C17H12BrF2N |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]naphthalen-1-amine |
| SMILES | Fc1ccc(Br)c(F)c1CNc1cccc2ccccc12 |
| InChI | InChI=1S/C17H12BrF2N/c18-14-8-9-15(19)13(17(14)20)10-21-16-7-3-5-11-4-1-2-6-12(11)16/h1-9,21H,10H2 |
| InChIKey | ODFYZRXQYWHNBE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|