C21H33N7O — CID 111321648
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-hydroxy-N-[3-(N-methylanilino)propyl]piperidine-1-carboximidamide (PubChem CID 111321648) has the molecular formula C21H33N7O and a molecular weight of 399.54 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-hydroxy-N-[3-(N-methylanilino)propyl]piperidine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-hydroxy-N-[3-(N-methylanilino)propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111321648 |
| Molecular Formula | C21H33N7O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-hydroxy-N-[3-(N-methylanilino)propyl]piperidine-1-carboximidamide |
| SMILES | Cc1nnc(C/N=C(\NCCCN(C)c2ccccc2)N2CCC(O)CC2)n1C |
| InChI | InChI=1S/C21H33N7O/c1-17-24-25-20(27(17)3)16-23-21(28-14-10-19(29)11-15-28)22-12-7-13-26(2)18-8-5-4-6-9-18/h4-6,8-9,19,29H,7,10-16H2,1-3H3,(H,22,23) |
| InChIKey | HUMDOQNKDALOFU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|