C19H36N8O — CID 111366601
2-[4-[N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 111366601) has the molecular formula C19H36N8O and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-[4-[N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 111366601 |
| Molecular Formula | C19H36N8O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | 2-[4-[N-butyl-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)N1CCN(CC(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C19H36N8O/c1-6-7-8-20-19(21-13-17-24-23-16(4)25(17)5)27-11-9-26(10-12-27)14-18(28)22-15(2)3/h15H,6-14H2,1-5H3,(H,20,21)(H,22,28) |
| InChIKey | NIQWPZFPMXZPRC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 90.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|