C19H25ClN6OS — CID 8727144
4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)-N-[2-(dimethylamino)ethyl]piperazine-1-carbothioamide (PubChem CID 8727144) has the molecular formula C19H25ClN6OS and a molecular weight of 420.97 g/mol. Its IUPAC name is 4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)-N-[2-(dimethylamino)ethyl]piperazine-1-carbothioamide.
| Compound Name | 4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)-N-[2-(dimethylamino)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8727144 |
| Molecular Formula | C19H25ClN6OS |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 4-(5-chloro-6-oxo-1-phenylpyridazin-4-yl)-N-[2-(dimethylamino)ethyl]piperazine-1-carbothioamide |
| SMILES | CN(C)CCNC(=S)N1CCN(c2cnn(-c3ccccc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C19H25ClN6OS/c1-23(2)9-8-21-19(28)25-12-10-24(11-13-25)16-14-22-26(18(27)17(16)20)15-6-4-3-5-7-15/h3-7,14H,8-13H2,1-2H3,(H,21,28) |
| InChIKey | FULUHWPDMKPWGL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 56.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|